| Product Name | 2-methyl-2-butenal |
| CAS No. | 497-03-0 |
| Synonyms | Methylbutenal; tiglaldehyde; guaiol; 2-Methylcrotonaldehyde~Tiglic aldehyde |
| InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.11 |
| Density | 0.871 |
| Boiling point | 115-118℃ (752 torr) |
| Flash point | 18℃ |
| Refractive index | 1.447 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
497-03-0 2-methyl-2-butenal
service@apichina.com