| Product Name | 2-methyl-1H-imidazole-4-carbothioamide |
| CAS No. | 129486-91-5 |
| Synonyms | 2-methyl-1H-imidazole-5-carbothioamide |
| InChI | InChI=1/C5H7N3S/c1-3-7-2-4(8-3)5(6)9/h2H,1H3,(H2,6,9)(H,7,8) |
| Molecular Formula | C5H7N3S |
| Molecular Weight | 141.1942 |
| Density | 1.359g/cm3 |
| Melting point | 194℃ |
| Boiling point | 424.7°C at 760 mmHg |
| Flash point | 210.6°C |
| Refractive index | 1.692 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
129486-91-5 2-methyl-1h-imidazole-4-carbothioamide
service@apichina.com