| Product Name | 2-Methyl-1-nitronaphthalene |
| CAS No. | 881-03-8 |
| Synonyms | Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
| InChI | InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.1947 |
| Density | 1.234g/cm3 |
| Melting point | 79-82℃ |
| Boiling point | 320.5°C at 760 mmHg |
| Flash point | 150.4°C |
| Refractive index | 1.652 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
881-03-8 2-methyl-1-nitronaphthalene
service@apichina.com