| Product Name | 2-Methyl-1-hexene |
| CAS No. | 6094-02-6 |
| Synonyms | 1-hexene, 2-methyl-; 2-Methyl-1-hexene; 2-Methylhex-1-ene |
| InChI | InChI=1/C7H14/c1-4-5-6-7(2)3/h2,4-6H2,1,3H3 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.1861 |
| Density | 0.706g/cm3 |
| Boiling point | 90.9°C at 760 mmHg |
| Refractive index | 1.404 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6094-02-6 2-methyl-1-hexene
service@apichina.com