| Product Name | 2-Methoxyphenylglyoxal hydrate |
| CAS No. | 27993-70-0 |
| Synonyms | (2-methoxyphenyl)(oxo)acetaldehyde |
| InChI | InChI=1/C9H8O3/c1-12-9-5-3-2-4-7(9)8(11)6-10/h2-6H,1H3 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Density | 1.153g/cm3 |
| Boiling point | 266.9°C at 760 mmHg |
| Flash point | 115°C |
| Refractive index | 1.518 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27993-70-0 2-methoxyphenylglyoxal hydrate
service@apichina.com