| Product Name | 2-Methoxyphenoxyacetic acid |
| CAS No. | 1878-85-9 |
| Synonyms | Guaiacoxyacetic acid; (2-Methoxyphenoxy)acetic acid; (o-Methoxyphenoxy)acetic acid; 3-06-00-04234 (Beilstein Handbook Reference); AI3-10575; Acide o-methoxyphenoxyacetique; Acide o-methoxyphenoxyacetique [French]; BRN 1874501; NSC 5165; Acetic acid, (2-methoxyphenoxy)-; Acetic acid, (o-methoxyphenoxy)-; (2-methoxyphenoxy)acetate |
| InChI | InChI=1/C9H10O4/c1-12-7-4-2-3-5-8(7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| Molecular Formula | C9H9O4 |
| Molecular Weight | 181.1659 |
| Melting point | 120-122℃ |
| Boiling point | 303°C at 760 mmHg |
| Flash point | 120.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1878-85-9 2-methoxyphenoxyacetic acid
service@apichina.com