| Product Name | 2-Methoxyhydroquinone |
| CAS No. | 824-46-4 |
| Synonyms | 2,5-Dihydroxyanisole; 2-methoxyquinol; 2-methoxybenzene-1,4-diol; Methoxy hydroquinone |
| InChI | InChI=1/C7H8O3/c1-10-7-4-5(8)2-3-6(7)9/h2-4,8-9H,1H3 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.1366 |
| Density | 1.27g/cm3 |
| Melting point | 89-91℃ |
| Boiling point | 311.3°C at 760 mmHg |
| Flash point | 142.1°C |
| Refractive index | 1.579 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
824-46-4 2-methoxyhydroquinone
service@apichina.com