| Product Name | 2-Methoxycrotonic acid |
| CAS No. | 38588-37-3 |
| Synonyms | 2-Methoxy-2-butenoic acid; (2Z)-2-methoxybut-2-enoic acid |
| InChI | InChI=1/C5H8O3/c1-3-4(8-2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3- |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.1152 |
| Density | 1.1g/cm3 |
| Boiling point | 204.2°C at 760 mmHg |
| Flash point | 85.8°C |
| Refractive index | 1.451 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
38588-37-3 2-methoxycrotonic acid
service@apichina.com