| Product Name | 2-methoxy-4-nitrophenyl isothiocyanate |
| CAS No. | 190774-55-1 |
| Synonyms | 1-isothiocyanato-2-methoxy-4-nitrobenzene |
| InChI | InChI=1/C8H6N2O3S/c1-13-8-4-6(10(11)12)2-3-7(8)9-5-14/h2-4H,1H3 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.2098 |
| Density | 1.33g/cm3 |
| Boiling point | 391.4°C at 760 mmHg |
| Flash point | 190.5°C |
| Refractive index | 1.604 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
190774-55-1 2-methoxy-4-nitrophenyl isothiocyanate
service@apichina.com