| Product Name | 2-methoxy-4-(methylthio)benzoic acid |
| CAS No. | 72856-73-6 |
| Synonyms | 4-(Methylthio)-o-anisic acid; 2-methoxy-4-(methylsulfanyl)benzoic acid |
| InChI | InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.2389 |
| Density | 1.29g/cm3 |
| Boiling point | 342.3°C at 760 mmHg |
| Flash point | 160.8°C |
| Refractive index | 1.592 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
72856-73-6 2-methoxy-4-(methylthio)benzoic acid
service@apichina.com