| Product Name | 2-methoxy-3,5-dimethyl-6-{(4Z)-4-[(2E)-2-methyl-3-(4-nitrophenyl)prop-2-en-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one |
| CAS No. | 2825-00-5 |
| Synonyms | (Z,E)-2-Methoxy-3,5-dimethyl-6-[tetrahydro-4-[2-methyl-3-(4-nitrophenyl)-2-propenylidene]-2-furanyl]-4H-pyran-4-one; 2825-00-5; 4H-pyran-4-one, 2-methoxy-3,5-dimethyl-6-[(4Z)-tetrahydro-4-[(2E)-2-methyl-3-(4-nitrophenyl)-2-propen-1-ylidene]-2-furanyl]-; 5-19-06-00099; Mycolutein |
| InChI | InChI=1/C22H23NO6/c1-13(9-16-5-7-18(8-6-16)23(25)26)10-17-11-19(28-12-17)21-14(2)20(24)15(3)22(27-4)29-21/h5-10,19H,11-12H2,1-4H3/b13-9+,17-10- |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.4211 |
| Density | 1.26g/cm3 |
| Boiling point | 591.4°C at 760 mmHg |
| Flash point | 235°C |
| Refractive index | 1.593 |
2825-00-5 2-methoxy-3,5-dimethyl-6-{(4z)-4-[(2e)-2-methyl-3-(4-nitrophenyl)prop-2-en-1-ylidene]tetra
service@apichina.com