| Product Name | 2-Methoxy-1-naphthonitrile |
| CAS No. | 16000-39-8 |
| Synonyms | 1-Cyano-2-methoxynaphtalene; 2-methoxynaphthalene-1-carbonitrile |
| InChI | InChI=1/C12H9NO/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-7H,1H3 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.206 |
| Density | 1.16g/cm3 |
| Melting point | 94-96℃ |
| Boiling point | 362.8°C at 760 mmHg |
| Flash point | 153°C |
| Refractive index | 1.622 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
16000-39-8 2-methoxy-1-naphthonitrile
service@apichina.com