| Product Name | 2-Mercaptobenzyl alcohol |
| CAS No. | 4521-31-7 |
| Synonyms | 2-(Hydroxymethyl)thiophenol; O-Mercaptobenzyl alcohol; (2-Sulfanylphenyl)methanol; 2- Mercaptobenzyl alcohol, tech.; 2-(hydroxymethyl)benzenethiolate |
| InChI | InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
| Molecular Formula | C7H7OS |
| Molecular Weight | 139.1954 |
| Melting point | 31-32℃ |
| Boiling point | 276.5°C at 760 mmHg |
| Flash point | 121°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4521-31-7 2-mercaptobenzyl alcohol
service@apichina.com