| Product Name | 2-Isopropylphenyl isothiocyanate |
| CAS No. | 36176-31-5 |
| Synonyms | 1-isothiocyanato-2-(propan-2-yl)benzene |
| InChI | InChI=1/C10H11NS/c1-8(2)9-5-3-4-6-10(9)11-7-12/h3-6,8H,1-2H3 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.266 |
| Density | 1g/cm3 |
| Boiling point | 268°C at 760 mmHg |
| Flash point | 117.3°C |
| Refractive index | 1.547 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
36176-31-5 2-isopropylphenyl isothiocyanate
service@apichina.com