| Product Name | (2-Isopropylphenyl)boronic acid |
| CAS No. | 89787-12-2 |
| Synonyms | 2-Isopropylbenzeneboronic acid; 2-Cumylboronic acid~2-Isopropylphenylboronic acid; [2-(1-methylethyl)phenyl]boronic acid; 2-Isopropylphenylboronic Acid |
| InChI | InChI=1/C9H13BO2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7,11-12H,1-2H3 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.0093 |
| Density | 1.04g/cm3 |
| Boiling point | 297.2°C at 760 mmHg |
| Flash point | 133.5°C |
| Refractive index | 1.513 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
89787-12-2 (2-isopropylphenyl)boronic acid
service@apichina.com