| Product Name | (2-Isopropoxyethyl) acetate |
| CAS No. | 19234-20-9 |
| Synonyms | Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
| InChI | InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.1843 |
| Density | 0.947g/cm3 |
| Boiling point | 177.6°C at 760 mmHg |
| Flash point | 56.8°C |
| Refractive index | 1.406 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
19234-20-9 (2-isopropoxyethyl) acetate
service@apichina.com