| Product Name | 2-isocyanatobenzonitrile |
| CAS No. | 42066-86-4 |
| Synonyms | 2-Cyanophenyl isocyanate |
| InChI | InChI=1/C8H4N2O/c9-5-7-3-1-2-4-8(7)10-6-11/h1-4H |
| Molecular Formula | C8H4N2O |
| Molecular Weight | 144.1302 |
| Density | 1.09g/cm3 |
| Melting point | 59℃ |
| Boiling point | 266.2°C at 760 mmHg |
| Flash point | 114.8°C |
| Refractive index | 1.562 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
42066-86-4 2-isocyanatobenzonitrile
service@apichina.com