| Product Name | 2-Iodophenylacetonitrile |
| CAS No. | 40400-15-5 |
| Synonyms | 2-Iodobenzyl cyanide |
| InChI | InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| Molecular Formula | C8H6IN |
| Molecular Weight | 243.0444 |
| Density | 1.764g/cm3 |
| Boiling point | 306°C at 760 mmHg |
| Flash point | 138.8°C |
| Refractive index | 1.624 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
40400-15-5 2-iodophenylacetonitrile
service@apichina.com