| Product Name | 2-Iodophenyl isothiocyanate |
| CAS No. | 98041-44-2 |
| Synonyms | 2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
| InChI | InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
| Molecular Formula | C7H4INS |
| Molecular Weight | 261.0828 |
| Density | 1.76g/cm3 |
| Melting point | 36-39℃ |
| Boiling point | 304.2°C at 760 mmHg |
| Flash point | 137.8°C |
| Refractive index | 1.672 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
98041-44-2 2-iodophenyl isothiocyanate
service@apichina.com