| Product Name | 2-Iodobiphenyl |
| CAS No. | 2113-51-1 |
| Synonyms | 1,1'-Biphenyl, 2-iodo-; 2-Iodo-1,1'-biphenyl; AI3-15371; Biphenyl, 2-iodo-; NSC 9283; o-Iodobiphenyl; o-Phenyliodobenzene; Biphenyl, 2-iodo- (6CI,7CI,8CI) |
| InChI | InChI=1/C12H9I/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| Molecular Formula | C12H9I |
| Molecular Weight | 280.1043 |
| Density | 1.584g/cm3 |
| Boiling point | 331.7°C at 760 mmHg |
| Flash point | 150.1°C |
| Refractive index | 1.64 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2113-51-1 2-iodobiphenyl
service@apichina.com