| Product Name | 2-Iodobenzaldehyde |
| CAS No. | 26260-02-6 |
| Synonyms | Benzaldehyde, 2-iodo- |
| InChI | InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| Molecular Formula | C7H5IO |
| Molecular Weight | 232.0185 |
| Density | 1.883g/cm3 |
| Melting point | 36-39℃ |
| Boiling point | 266.3°C at 760 mmHg |
| Flash point | 114.8°C |
| Refractive index | 1.668 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
26260-02-6 2-iodobenzaldehyde
service@apichina.com