| Product Name | 2-Iodoacetophenone |
| CAS No. | 2142-70-3 |
| Synonyms | 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
| InChI | InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| Molecular Formula | C8H7IO |
| Molecular Weight | 246.045 |
| Density | 1.72g/cm3 |
| Boiling point | 268.2°C at 760 mmHg |
| Flash point | 116°C |
| Refractive index | 1.603 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2142-70-3 2-iodoacetophenone
service@apichina.com