| Product Name | 2-iodo-p-xylene |
| CAS No. | 1122-42-5 |
| Synonyms | 2,5-Dimethyl-1-iodobenzene; 2-Iodo-1,4-dimethylbenzene; 2-iodo-1,4-dimethylbenzene; 1,4-Dimethyl-2-iodobenzene |
| InChI | InChI=1/C8H9I/c1-6-3-4-7(2)8(9)5-6/h3-5H,1-2H3 |
| Molecular Formula | C8H9I |
| Molecular Weight | 232.0615 |
| Density | 1.61g/cm3 |
| Boiling point | 227.8°C at 760 mmHg |
| Flash point | 98.2°C |
| Refractive index | 1.592 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1122-42-5 2-iodo-p-xylene
service@apichina.com