| Product Name | 2-Iodo-m-xylene |
| CAS No. | 608-28-6 |
| Synonyms | 2-Iodo-1,3-Dimethylbenzene |
| InChI | InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| Molecular Formula | C8H9I |
| Molecular Weight | 232.0615 |
| Density | 1.61g/cm3 |
| Boiling point | 227.5°C at 760 mmHg |
| Flash point | 98.1°C |
| Water solubility | insoluble |
| Refractive index | 1.592 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection; |
608-28-6 2-iodo-m-xylene
service@apichina.com
- Next:608-29-7 1,2,3-triiodobenzene
- Previous:608-27-5 2,3-dichloroaniline