| Product Name | 2-Iodo-5-nitrotoluene |
| CAS No. | 5326-38-5 |
| Synonyms | 1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
| InChI | InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.3098 |
| Density | 1.217g/cm3 |
| Boiling point | 531.5°C at 760 mmHg |
| Flash point | 275.2°C |
| Refractive index | 1.665 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5326-38-5 2-iodo-5-nitrotoluene
service@apichina.com