| Product Name | 2-Iodo-4-nitrotoluene |
| CAS No. | 7745-92-8 |
| Synonyms | 1-Nitro-3-iodo-4-methylbenzene |
| InChI | InChI=1/C7H6INO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| Molecular Formula | C7H6INO2 |
| Molecular Weight | 263.03 |
| Melting point | 60-62℃ |
| Boiling point | 164-165℃(15 torr) |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7745-92-8 2-iodo-4-nitrotoluene
service@apichina.com