| Product Name | 2-Iodo-3-methylpyridine |
| CAS No. | 22282-58-2 |
| Synonyms | 2-Iodo-3-picoline |
| InChI | InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| Molecular Formula | C6H6IN |
| Molecular Weight | 219.023 |
| Density | 1.81g/cm3 |
| Boiling point | 237.412°C at 760 mmHg |
| Flash point | 97.384°C |
| Refractive index | 1.612 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
22282-58-2 2-iodo-3-methylpyridine
service@apichina.com