| Product Name | 2-Iodo-3-methoxypyridine |
| CAS No. | 93560-55-5 |
| InChI | InChI=1/C6H6INO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| Molecular Formula | C6H6INO |
| Molecular Weight | 235.0224 |
| Density | 1.825g/cm3 |
| Boiling point | 271.2°C at 760 mmHg |
| Flash point | 117.8°C |
| Refractive index | 1.598 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
93560-55-5 2-iodo-3-methoxypyridine
service@apichina.com