| Product Name | 2-Indanylboronic acid diethanolamine cyclic ester |
| CAS No. | 501014-44-4 |
| Synonyms | 2-(2,3-dihydro-1H-inden-2-yl)-1,3,6,2-dioxazaborocane |
| InChI | InChI=1/C13H18BNO2/c1-2-4-12-10-13(9-11(12)3-1)14-16-7-5-15-6-8-17-14/h1-4,13,15H,5-10H2 |
| Molecular Formula | C13H18BNO2 |
| Molecular Weight | 231.0985 |
| Density | 1.101g/cm3 |
| Boiling point | 350.733°C at 760 mmHg |
| Flash point | 165.917°C |
| Refractive index | 1.538 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
501014-44-4 2-indanylboronic acid diethanolamine cyclic ester
service@apichina.com