| Product Name | 2-Indanylacetic acid |
| CAS No. | 37868-26-1 |
| Synonyms | 2,3-dihydro-1H-inden-1-ylacetic acid |
| InChI | InChI=1/C11H12O2/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-7H2,(H,12,13) |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.2118 |
| Density | 1.169g/cm3 |
| Boiling point | 343.28°C at 760 mmHg |
| Flash point | 240.264°C |
| Refractive index | 1.568 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
37868-26-1 2-indanylacetic acid
service@apichina.com