| Product Name | 2-Hydroxythiophenol |
| CAS No. | 1121-24-0 |
| Synonyms | 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| InChI | InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| Molecular Formula | C6H6OS |
| Molecular Weight | 126.1762 |
| Density | 1.255g/cm3 |
| Boiling point | 223.7°C at 760 mmHg |
| Flash point | 89.1°C |
| Refractive index | 1.642 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1121-24-0 2-hydroxythiophenol
service@apichina.com