| Product Name | 2-Hydroxythioanisole |
| CAS No. | 1073-29-6 |
| Synonyms | 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| InChI | InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.2028 |
| Density | 1.19g/cm3 |
| Boiling point | 206.1°C at 760 mmHg |
| Flash point | 108°C |
| Refractive index | 1.613 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1073-29-6 2-hydroxythioanisole
service@apichina.com