| Product Name | (2-hydroxyphenoxy)acetic acid |
| CAS No. | 6324-11-4 |
| Synonyms | 2-Hydroxyphenoxyacetic acid |
| InChI | InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.1467 |
| Density | 1.367g/cm3 |
| Melting point | 138-141℃ |
| Boiling point | 339.6°C at 760 mmHg |
| Flash point | 143°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6324-11-4 (2-hydroxyphenoxy)acetic acid
service@apichina.com