| Product Name | 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester |
| CAS No. | 5735-41-1 |
| Synonyms | 1-Hydroxy-2,1-benzoxaborolane~2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2,1-benzoxaborol-1(3H)-ol; [2-(hydroxymethyl)phenyl]boronic acid |
| InChI | InChI=1/C7H9BO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9-11H,5H2 |
| Molecular Formula | C7H9BO3 |
| Molecular Weight | 151.9556 |
| Density | 1.25g/cm3 |
| Melting point | 95-100℃ |
| Boiling point | 379.8°C at 760 mmHg |
| Flash point | 183.5°C |
| Refractive index | 1.566 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5735-41-1 2-(hydroxymethyl)benzeneboronic acid cyclic monoester
service@apichina.com