| Product Name | 2-hydroxyimino-2-phenylacetonitrile, mixture |
| CAS No. | 825-52-5 |
| Synonyms | 2-Hydroxyimino-2-phenylacetonitrile; Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime; (hydroxyimino)(phenyl)acetonitrile; (2E)-(hydroxyimino)(phenyl)ethanenitrile |
| InChI | InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.146 |
| Density | 1.11g/cm3 |
| Melting point | 128-130℃ |
| Boiling point | 293.3°C at 760 mmHg |
| Flash point | 131.2°C |
| Refractive index | 1.562 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture
service@apichina.com