| Product Name | 2-Hydroxycarbazole |
| CAS No. | 86-79-3 |
| Synonyms | carbazol-2-ol; 9H-carbazol-2-ol |
| InChI | InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.206 |
| Density | 1.362g/cm3 |
| Melting point | 273-275℃ |
| Boiling point | 431.4°C at 760 mmHg |
| Flash point | 214.7°C |
| Refractive index | 1.815 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
86-79-3 2-hydroxycarbazole
service@apichina.com