| Product Name | 2-Hydroxybenzeneboronic acid |
| CAS No. | 89466-08-0 |
| Synonyms | 2-Boronophenol; 2-Hydroxyphenylboronic acid |
| InChI | InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
| Molecular Formula | C6H7BO3 |
| Molecular Weight | 137.929 |
| Density | 1.32g/cm3 |
| Boiling point | 327.3°C at 760 mmHg |
| Flash point | 151.7°C |
| Refractive index | 1.582 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
89466-08-0 2-hydroxybenzeneboronic acid
service@apichina.com