| Product Name | 2-(hydroxyamino)cyclohexan-1-one oxime acetate |
| CAS No. | 13785-65-4 |
| Synonyms | (1Z)-2-(hydroxyamino)cyclohexanone oxime acetate (salt) |
| InChI | InChI=1/C6H12N2O2.C2H4O2/c9-7-5-3-1-2-4-6(5)8-10;1-2(3)4/h5,7,9-10H,1-4H2;1H3,(H,3,4)/b8-6-; |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.2236 |
| Melting point | 132℃ |
| Boiling point | 334.6°C at 760 mmHg |
| Flash point | 156.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13785-65-4 2-(hydroxyamino)cyclohexan-1-one oxime acetate
service@apichina.com