| Product Name | 2-Hydroxy-6-methoxyacetophenone |
| CAS No. | 703-23-1 |
| Synonyms | 1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
| InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.1739 |
| Density | 1.158g/cm3 |
| Melting point | 58-60℃ |
| Boiling point | 259.5°C at 760 mmHg |
| Flash point | 108.1°C |
| Refractive index | 1.537 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
703-23-1 2-hydroxy-6-methoxyacetophenone
service@apichina.com