| Product Name | 2-Hydroxy-5-nitro-3-picoline |
| CAS No. | 21901-34-8 |
| Synonyms | 3-Methyl-5-nitro-2-pyridone; 3-Methyl-5-nitro-2-pyridinol; 2-Hydroxy-3-methyl-5-nitropyridine; 3-methyl-5-nitropyridin-2(1H)-one; 3-methyl-5-nitropyridin-2-ol |
| InChI | InChI=1/C6H6N2O3/c1-4-2-5(8(10)11)3-7-6(4)9/h2-3H,1H3,(H,7,9) |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.1234 |
| Density | 1.36g/cm3 |
| Boiling point | 327.2°C at 760 mmHg |
| Flash point | 151.7°C |
| Refractive index | 1.567 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
21901-34-8 2-hydroxy-5-nitro-3-picoline
service@apichina.com