| Product Name | 2-Hydroxy-4,6-dimethoxybenzoic acid |
| CAS No. | 3187-19-7 |
| Synonyms | 4,6-Dimethoxy-2-hydroxybenzoic acid~4,6-Dimethoxysalicylic acid |
| InChI | InChI=1/C9H10O5/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4,10H,1-2H3,(H,11,12) |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.1727 |
| Density | 1.335g/cm3 |
| Boiling point | 371°C at 760 mmHg |
| Flash point | 151.1°C |
| Refractive index | 1.566 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3187-19-7 2-hydroxy-4,6-dimethoxybenzoic acid
service@apichina.com