| Product Name | 2-Hydroxy-4,6-dimethoxyacetophenone |
| CAS No. | 90-24-4 |
| Synonyms | xanthoxylin |
| InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.1999 |
| Density | 1.172g/cm3 |
| Melting point | 80-82℃ |
| Boiling point | 355.1°C at 760 mmHg |
| Flash point | 141.2°C |
| Refractive index | 1.527 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
90-24-4 2-hydroxy-4,6-dimethoxyacetophenone
service@apichina.com