| Product Name | 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde |
| CAS No. | 17028-61-4 |
| Synonyms | 3-Methoxy-5-nitrosalicylaldehyde; 2-formyl-6-methoxy-4-nitrophenolate |
| InChI | InChI=1/C8H7NO5/c1-14-7-3-6(9(12)13)2-5(4-10)8(7)11/h2-4,11H,1H3/p-1 |
| Molecular Formula | C8H6NO5 |
| Molecular Weight | 196.1375 |
| Melting point | 140-142℃ |
| Boiling point | 344°C at 760 mmHg |
| Flash point | 161.8°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17028-61-4 2-hydroxy-3-methoxy-5-nitrobenzaldehyde
service@apichina.com