| Product Name | 2-Furylglyoxylonitrile |
| CAS No. | 6047-91-2 |
| Synonyms | 2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| InChI | InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| Molecular Formula | C6H3NO2 |
| Molecular Weight | 121.0935 |
| Density | 1.246g/cm3 |
| Melting point | 19-87℃ |
| Boiling point | 175.8°C at 760 mmHg |
| Flash point | 60.1°C |
| Refractive index | 1.498 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6047-91-2 2-furylglyoxylonitrile
service@apichina.com