| Product Name | 2-Furoylacetonitrile |
| CAS No. | 31909-58-7 |
| Synonyms | 3-(furan-2-yl)-3-oxopropanenitrile |
| InChI | InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.1201 |
| Density | 1.188g/cm3 |
| Melting point | 76-83℃ |
| Boiling point | 297.2°C at 760 mmHg |
| Flash point | 133.6°C |
| Refractive index | 1.494 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
31909-58-7 2-furoylacetonitrile
service@apichina.com