| Product Name | 2-Formylthiophene-3-boronic acid |
| CAS No. | 4347-31-3 |
| Synonyms | 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
| InChI | InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| Molecular Formula | C5H5BO3S |
| Molecular Weight | 155.9674 |
| Density | 1.41g/cm3 |
| Melting point | 167-173℃ |
| Boiling point | 396.7°C at 760 mmHg |
| Flash point | 193.7°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4347-31-3 2-formylthiophene-3-boronic acid
service@apichina.com