| Product Name | 2-Fluoropyridine-3-boronic acid |
| CAS No. | 174669-73-9 |
| Synonyms | 2-Fluoro-3-pyridylboronic acid; Boronic acid, B-(2-fluoro-3-pyridinyl)- ; (2-fluoropyridin-3-yl)boronic acid hydrate; (2-fluoropyridin-3-yl)boronic acid; 2-FLUORO-3-PYRIDINEBORONIC ACID; 2-Fluoropyridin-3-Ylboronic Acid |
| InChI | InChI=1/C5H5BFNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3,9-10H |
| Molecular Formula | C5H5BFNO2 |
| Molecular Weight | 140.9081 |
| Density | 1.34g/cm3 |
| Boiling point | 322.6°C at 760 mmHg |
| Flash point | 148.9°C |
| Refractive index | 1.507 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
174669-73-9 2-fluoropyridine-3-boronic acid
service@apichina.com