| Product Name | 2-Fluorophenylglyoxal hydrate |
| CAS No. | 170880-96-3 |
| Synonyms | (2-fluorophenyl)(oxo)acetaldehyde hydrate; 2-(2-fluorophenyl)-2-oxoacetaldehyde |
| InChI | InChI=1/C8H5FO2.H2O/c9-7-4-2-1-3-6(7)8(11)5-10;/h1-5H;1H2 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.1378 |
| Boiling point | 212.8°C at 760 mmHg |
| Flash point | 79.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
170880-96-3 2-fluorophenylglyoxal hydrate
service@apichina.com