| Product Name | 2-Fluorophenethylamine |
| CAS No. | 52721-69-4 |
| Synonyms | 2-(2-Fluorophenyl)-ethylamine; 2-(2-fluorophenyl)ethanamine; 2-(2-fluorophenyl)ethanaminium; 2-Fluoro-benzeneethanamine |
| InChI | InChI=1/C8H10FN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2/p+1 |
| Molecular Formula | C8H11FN |
| Molecular Weight | 140.1775 |
| Boiling point | 242.8°C at 760 mmHg |
| Flash point | 77.2°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
52721-69-4 2-fluorophenethylamine
service@apichina.com