| Product Name | 2-Fluorobiphenyl-4-boronic acid |
| CAS No. | 178305-99-2 |
| Synonyms | 3-Fluoro-4-phenylbenzeneboronic acid; 2-Fluoro-4-biphenylylboronic acid; (2-fluorobiphenyl-4-yl)boronic acid; (3-fluorobiphenyl-4-yl)boronic acid |
| InChI | InChI=1/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H |
| Molecular Formula | C12H10BFO2 |
| Molecular Weight | 216.016 |
| Density | 1.257g/cm3 |
| Melting point | 243-248℃ |
| Boiling point | 384.155°C at 760 mmHg |
| Flash point | 186.131°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
178305-99-2 2-fluorobiphenyl-4-boronic acid
service@apichina.com